C12H10N4OS — CID 135608237
4-[(E)-1,3-benzothiazol-2-yliminomethyl]-5-methyl-1,2-dihydropyrazol-3-one (PubChem CID 135608237) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 4-[(E)-1,3-benzothiazol-2-yliminomethyl]-5-methyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(E)-1,3-benzothiazol-2-yliminomethyl]-5-methyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135608237 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-[(E)-1,3-benzothiazol-2-yliminomethyl]-5-methyl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1/C=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H10N4OS/c1-7-8(11(17)16-15-7)6-13-12-14-9-4-2-3-5-10(9)18-12/h2-6H,1H3,(H2,15,16,17)/b13-6+ |
| InChIKey | LJQIVLFKFBMZDW-AWNIVKPZSA-N |
| XLogP | 2.37 |
| TPSA | 73.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|