C11H10FN3O — CID 135463019
4-[(4-fluorophenyl)iminomethyl]-5-methyl-1,2-dihydropyrazol-3-one (PubChem CID 135463019) has the molecular formula C11H10FN3O and a molecular weight of 219.22 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)iminomethyl]-5-methyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(4-fluorophenyl)iminomethyl]-5-methyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135463019 |
| Molecular Formula | C11H10FN3O |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-[(4-fluorophenyl)iminomethyl]-5-methyl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1/C=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C11H10FN3O/c1-7-10(11(16)15-14-7)6-13-9-4-2-8(12)3-5-9/h2-6H,1H3,(H2,14,15,16)/b13-6+ |
| InChIKey | CSWZJLIRWSENSM-AWNIVKPZSA-N |
| XLogP | 1.90 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|