C17H11F4N3O2 — CID 137309866
5-(3-fluorophenyl)-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one (PubChem CID 137309866) has the molecular formula C17H11F4N3O2 and a molecular weight of 365.29 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-(3-fluorophenyl)-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 137309866 |
| Molecular Formula | C17H11F4N3O2 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 5-(3-fluorophenyl)-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(-c2cccc(F)c2)c1/C=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F4N3O2/c18-11-3-1-2-10(8-11)15-14(16(25)24-23-15)9-22-12-4-6-13(7-5-12)26-17(19,20)21/h1-9H,(H2,23,24,25)/b22-9+ |
| InChIKey | INNMTFIPGZJHCP-LSFURLLWSA-N |
| XLogP | 4.16 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|