C24H15F5N2O — CID 11669393
2,6-bis(3-fluorophenyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-4-amine (PubChem CID 11669393) has the molecular formula C24H15F5N2O and a molecular weight of 442.39 g/mol. Its IUPAC name is 2,6-bis(3-fluorophenyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-4-amine.
| Compound Name | 2,6-bis(3-fluorophenyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 11669393 |
| Molecular Formula | C24H15F5N2O |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2,6-bis(3-fluorophenyl)-N-[4-(trifluoromethoxy)phenyl]pyridin-4-amine |
| SMILES | Fc1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)cc(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C24H15F5N2O/c25-17-5-1-3-15(11-17)22-13-20(14-23(31-22)16-4-2-6-18(26)12-16)30-19-7-9-21(10-8-19)32-24(27,28)29/h1-14H,(H,30,31) |
| InChIKey | LZGMZVZRKBLUAN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |