C23H13F5N2O — CID 90750927
4,6-bis(4-fluorophenyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidine (PubChem CID 90750927) has the molecular formula C23H13F5N2O and a molecular weight of 428.36 g/mol. Its IUPAC name is 4,6-bis(4-fluorophenyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidine.
| Compound Name | 4,6-bis(4-fluorophenyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 90750927 |
| Molecular Formula | C23H13F5N2O |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4,6-bis(4-fluorophenyl)-2-[3-(trifluoromethoxy)phenyl]pyrimidine |
| SMILES | Fc1ccc(-c2cc(-c3ccc(F)cc3)nc(-c3cccc(OC(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C23H13F5N2O/c24-17-8-4-14(5-9-17)20-13-21(15-6-10-18(25)11-7-15)30-22(29-20)16-2-1-3-19(12-16)31-23(26,27)28/h1-13H |
| InChIKey | ZTMPVOLMFYWZHD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |