C12H9F3IN3O — CID 107105171
5-iodo-6-methyl-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 107105171) has the molecular formula C12H9F3IN3O and a molecular weight of 395.12 g/mol. Its IUPAC name is 5-iodo-6-methyl-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 5-iodo-6-methyl-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107105171 |
| Molecular Formula | C12H9F3IN3O |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 5-iodo-6-methyl-2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | Cc1nc(-c2cccc(OC(F)(F)F)c2)nc(N)c1I |
| InChI | InChI=1S/C12H9F3IN3O/c1-6-9(16)10(17)19-11(18-6)7-3-2-4-8(5-7)20-12(13,14)15/h2-5H,1H3,(H2,17,18,19) |
| InChIKey | OVGALENADJDHCJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|