C11H11F3N4O — CID 107105132
2-methyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine (PubChem CID 107105132) has the molecular formula C11H11F3N4O and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-methyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine.
| Compound Name | 2-methyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine |
|---|---|
| PubChem CID | 107105132 |
| Molecular Formula | C11H11F3N4O |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-methyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine |
| SMILES | Cc1nc(-c2cccc(OC(F)(F)F)c2)c(N)n1N |
| InChI | InChI=1S/C11H11F3N4O/c1-6-17-9(10(15)18(6)16)7-3-2-4-8(5-7)19-11(12,13)14/h2-5H,15-16H2,1H3 |
| InChIKey | BETAOSPEYDJYKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |