C13H13F3N4O — CID 107105134
2-cyclopropyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine (PubChem CID 107105134) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-cyclopropyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine.
| Compound Name | 2-cyclopropyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine |
|---|---|
| PubChem CID | 107105134 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-cyclopropyl-4-[3-(trifluoromethoxy)phenyl]imidazole-1,5-diamine |
| SMILES | Nc1c(-c2cccc(OC(F)(F)F)c2)nc(C2CC2)n1N |
| InChI | InChI=1S/C13H13F3N4O/c14-13(15,16)21-9-3-1-2-8(6-9)10-11(17)20(18)12(19-10)7-4-5-7/h1-3,6-7H,4-5,17-18H2 |
| InChIKey | XHKTWKISUIFHCW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |