C14H12F3N3O — CID 107105125
2-methyl-3-prop-2-ynyl-5-[3-(trifluoromethoxy)phenyl]imidazol-4-amine (PubChem CID 107105125) has the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-methyl-3-prop-2-ynyl-5-[3-(trifluoromethoxy)phenyl]imidazol-4-amine.
| Compound Name | 2-methyl-3-prop-2-ynyl-5-[3-(trifluoromethoxy)phenyl]imidazol-4-amine |
|---|---|
| PubChem CID | 107105125 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-methyl-3-prop-2-ynyl-5-[3-(trifluoromethoxy)phenyl]imidazol-4-amine |
| SMILES | C#CCn1c(C)nc(-c2cccc(OC(F)(F)F)c2)c1N |
| InChI | InChI=1S/C14H12F3N3O/c1-3-7-20-9(2)19-12(13(20)18)10-5-4-6-11(8-10)21-14(15,16)17/h1,4-6,8H,7,18H2,2H3 |
| InChIKey | WGKDYQBTEPPDOM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|