C15H11F3N4O — CID 71694720
2-[3-[3-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]aniline (PubChem CID 71694720) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 2-[3-[3-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]aniline.
| Compound Name | 2-[3-[3-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]aniline |
|---|---|
| PubChem CID | 71694720 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[3-[3-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]aniline |
| SMILES | Nc1ccccc1-c1nc(-c2cccc(OC(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)23-10-5-3-4-9(8-10)13-20-14(22-21-13)11-6-1-2-7-12(11)19/h1-8H,19H2,(H,20,21,22) |
| InChIKey | AJIHZJLAAGDLND-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|