C16H11F3N2OS — CID 71463182
4-[2-[3-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazol-2-amine (PubChem CID 71463182) has the molecular formula C16H11F3N2OS and a molecular weight of 336.34 g/mol. Its IUPAC name is 4-[2-[3-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[3-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 71463182 |
| Molecular Formula | C16H11F3N2OS |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-[2-[3-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2-c2cccc(OC(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C16H11F3N2OS/c17-16(18,19)22-11-5-3-4-10(8-11)12-6-1-2-7-13(12)14-9-23-15(20)21-14/h1-9H,(H2,20,21) |
| InChIKey | BSUUSNNJXUZPTQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |