C12H7FN4O3S — CID 135657877
5-[(E)-(6-fluoro-1,3-benzothiazol-2-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 135657877) has the molecular formula C12H7FN4O3S and a molecular weight of 306.28 g/mol. Its IUPAC name is 5-[(E)-(6-fluoro-1,3-benzothiazol-2-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-(6-fluoro-1,3-benzothiazol-2-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135657877 |
| Molecular Formula | C12H7FN4O3S |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 5-[(E)-(6-fluoro-1,3-benzothiazol-2-yl)iminomethyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C=N/c2nc3ccc(F)cc3s2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H7FN4O3S/c13-5-1-2-7-8(3-5)21-12(15-7)14-4-6-9(18)16-11(20)17-10(6)19/h1-4H,(H3,16,17,18,19,20)/b14-4+ |
| InChIKey | OQXDZPKJMMZNBT-LNKIKWGQSA-N |
| XLogP | 1.27 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|