C15H11N3S2 — CID 71219201
N-(1,3-benzothiazol-2-yl)-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 71219201) has the molecular formula C15H11N3S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 71219201 |
| Molecular Formula | C15H11N3S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1c(=Nc2nc3ccccc3s2)sc2ccccc21 |
| InChI | InChI=1S/C15H11N3S2/c1-18-11-7-3-5-9-13(11)20-15(18)17-14-16-10-6-2-4-8-12(10)19-14/h2-9H,1H3 |
| InChIKey | DTZPWJKEPNIZEO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |