C15H12N2O3S2 — CID 132518588
methyl (Z)-3-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enoate (PubChem CID 132518588) has the molecular formula C15H12N2O3S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is methyl (Z)-3-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | methyl (Z)-3-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 132518588 |
| Molecular Formula | C15H12N2O3S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | methyl (Z)-3-amino-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(furan-2-yl)prop-2-enoate |
| SMILES | COC(=O)/C(Sc1nc2ccccc2s1)=C(/N)c1ccco1 |
| InChI | InChI=1S/C15H12N2O3S2/c1-19-14(18)13(12(16)10-6-4-8-20-10)22-15-17-9-5-2-3-7-11(9)21-15/h2-8H,16H2,1H3/b13-12- |
| InChIKey | HWUNZFACUVSOHX-SEYXRHQNSA-N |
| XLogP | 3.48 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|