C17H21N3O2S2 — CID 88660859
O-(1,3-benzothiazol-2-yl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate (PubChem CID 88660859) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is O-(1,3-benzothiazol-2-yl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate.
| Compound Name | O-(1,3-benzothiazol-2-yl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate |
|---|---|
| PubChem CID | 88660859 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | O-(1,3-benzothiazol-2-yl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate |
| SMILES | CC(C)N(CC(=O)[C@H]1CCCN1)C(=S)Oc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-11(2)20(10-14(21)12-7-5-9-18-12)17(23)22-16-19-13-6-3-4-8-15(13)24-16/h3-4,6,8,11-12,18H,5,7,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | IKPOWFZRTOPKCS-GFCCVEGCSA-N |
| XLogP | 2.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|