C17H23ClN6O2S — CID 88657360
O-(1-phenyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate;hydrochloride (PubChem CID 88657360) has the molecular formula C17H23ClN6O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is O-(1-phenyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate;hydrochloride.
| Compound Name | O-(1-phenyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate;hydrochloride |
|---|---|
| PubChem CID | 88657360 |
| Molecular Formula | C17H23ClN6O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | O-(1-phenyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamothioate;hydrochloride |
| SMILES | CC(C)N(CC(=O)[C@@H]1CCCN1)C(=S)Oc1nnnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C17H22N6O2S.ClH/c1-12(2)22(11-15(24)14-9-6-10-18-14)17(26)25-16-19-20-21-23(16)13-7-4-3-5-8-13;/h3-5,7-8,12,14,18H,6,9-11H2,1-2H3;1H/t14-;/m0./s1 |
| InChIKey | OWWIXVIITCTRPN-UQKRIMTDSA-N |
| XLogP | 1.78 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|