About (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride
(1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride (PubChem CID 18606677) has the molecular formula C12H21ClN6O3S
and a molecular weight of 364.86 g/mol. Its IUPAC name is (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride |
| PubChem CID | 18606677 |
| Molecular Formula | C12H21ClN6O3S |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride |
| SMILES | CCCSN(CC(=O)[C@@H]1CCCN1)C(=O)Oc1nnnn1C.Cl |
| InChI | InChI=1S/C12H20N6O3S.ClH/c1-3-7-22-18(8-10(19)9-5-4-6-13-9)12(20)21-11-14-15-16-17(11)2;/h9,13H,3-8H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | GCEZLWAFYPAPBP-FVGYRXGTSA-N |
| XLogP | 0.81 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride?
The IUPAC name of (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride (CID 18606677) is (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride.
What is the SMILES notation for (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride?
The canonical SMILES for (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride is CCCSN(CC(=O)[C@@H]1CCCN1)C(=O)Oc1nnnn1C.Cl.
What is the InChIKey of (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride?
The InChIKey is GCEZLWAFYPAPBP-FVGYRXGTSA-N. The full InChI is InChI=1S/C12H20N6O3S.ClH/c1-3-7-22-18(8-10(19)9-5-4-6-13-9)12(20)21-11-14-15-16-17(11)2;/h9,13H,3-8H2,1-2H3;1H/t9-;/m0./s1.
What are the key properties of (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride?
(1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride has a molecular weight of 364.86 g/mol, XLogP of 0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyltetrazol-5-yl) N-[2-oxo-2-[(2S)-pyrrolidin-2-yl]ethyl]-N-propylsulfanylcarbamate;hydrochloride is sourced from PubChem (CID 18606677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).