C16H21N3O5 — CID 70092529
(4-nitrophenyl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamate (PubChem CID 70092529) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is (4-nitrophenyl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamate.
| Compound Name | (4-nitrophenyl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 70092529 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (4-nitrophenyl) N-[2-oxo-2-[(2R)-pyrrolidin-2-yl]ethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CC(=O)[C@H]1CCCN1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H21N3O5/c1-11(2)18(10-15(20)14-4-3-9-17-14)16(21)24-13-7-5-12(6-8-13)19(22)23/h5-8,11,14,17H,3-4,9-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | WYKKIPPGOUHMJH-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|