C11H11N3O6 — CID 15788336
(2,4-dinitrophenyl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 15788336) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is (2,4-dinitrophenyl) (2S)-pyrrolidine-2-carboxylate.
| Compound Name | (2,4-dinitrophenyl) (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15788336 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (2,4-dinitrophenyl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H11N3O6/c15-11(8-2-1-5-12-8)20-10-4-3-7(13(16)17)6-9(10)14(18)19/h3-4,6,8,12H,1-2,5H2/t8-/m0/s1 |
| InChIKey | GWMPRRUHGOFNRJ-QMMMGPOBSA-N |
| XLogP | 1.16 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|