About calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate
calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate (PubChem CID 174892600) has the molecular formula C5H10CaN2O4
and a molecular weight of 202.22 g/mol. Its IUPAC name is calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 174892600 |
| Molecular Formula | C5H10CaN2O4 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(O[N+](=O)[O-])[C@@H]1CCCN1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C5H8N2O4.Ca.2H/c8-5(11-7(9)10)4-2-1-3-6-4;;;/h4,6H,1-3H2;;;/q;+2;2*-1/t4-;;;/m0.../s1 |
| InChIKey | NTWDZDWOSJVHPI-WJXVXWFNSA-N |
| XLogP | -0.68 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate (CID 174892600) is calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate is O=C(O[N+](=O)[O-])[C@@H]1CCCN1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate?
The InChIKey is NTWDZDWOSJVHPI-WJXVXWFNSA-N. The full InChI is InChI=1S/C5H8N2O4.Ca.2H/c8-5(11-7(9)10)4-2-1-3-6-4;;;/h4,6H,1-3H2;;;/q;+2;2*-1/t4-;;;/m0.../s1.
What are the key properties of calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate?
calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate has a molecular weight of 202.22 g/mol, XLogP of -0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;nitro (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 174892600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).