potassium (2S)-pyrrolidine-2-carboxylate

C5H8KNO2 — CID 23681229

IUPACpotassium (2S)-pyrrolidine-2-carboxylate
SMILESO=C([O-])[C@@H]1CCCN1.[K+]
InChIInChI=1S/C5H9NO2.K/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/q;+1/p-1/t4-;/m0./s1
InChIKeyMFSZVOKHTMONOW-WCCKRBBISA-M
MW153.22 g/mol
LogP-4.51
Rot. Bonds1

About potassium (2S)-pyrrolidine-2-carboxylate

potassium (2S)-pyrrolidine-2-carboxylate (PubChem CID 23681229) has the molecular formula C5H8KNO2 and a molecular weight of 153.22 g/mol. Its IUPAC name is potassium (2S)-pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namepotassium (2S)-pyrrolidine-2-carboxylate
PubChem CID23681229
Molecular FormulaC5H8KNO2
Molecular Weight153.22 g/mol
Exact Mass153.02
IUPAC Namepotassium (2S)-pyrrolidine-2-carboxylate
SMILESO=C([O-])[C@@H]1CCCN1.[K+]
InChIInChI=1S/C5H9NO2.K/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/q;+1/p-1/t4-;/m0./s1
InChIKeyMFSZVOKHTMONOW-WCCKRBBISA-M
XLogP-4.51
TPSA52.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.22
LogP ≤ 5-4.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze potassium (2S)-pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of potassium (2S)-pyrrolidine-2-carboxylate (CID 23681229) is potassium (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for potassium (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for potassium (2S)-pyrrolidine-2-carboxylate is O=C([O-])[C@@H]1CCCN1.[K+].
What is the InChIKey of potassium (2S)-pyrrolidine-2-carboxylate?
The InChIKey is MFSZVOKHTMONOW-WCCKRBBISA-M. The full InChI is InChI=1S/C5H9NO2.K/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/q;+1/p-1/t4-;/m0./s1.
What are the key properties of potassium (2S)-pyrrolidine-2-carboxylate?
potassium (2S)-pyrrolidine-2-carboxylate has a molecular weight of 153.22 g/mol, XLogP of -4.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 23681229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).