About (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium
(2S)-pyrrolidine-2-carboxylate;tetrapropylazanium (PubChem CID 24866401) has the molecular formula C17H36N2O2
and a molecular weight of 300.49 g/mol. Its IUPAC name is (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium.
Molecular Properties
| Compound Name | (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium |
| PubChem CID | 24866401 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.O=C([O-])[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H28N.C5H9NO2/c1-5-9-13(10-6-2,11-7-3)12-8-4;7-5(8)4-2-1-3-6-4/h5-12H2,1-4H3;4,6H,1-3H2,(H,7,8)/q+1;/p-1/t;4-/m.0/s1 |
| InChIKey | OWAAZPCZDYPEFJ-VWMHFEHESA-M |
| XLogP | 1.93 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium?
The IUPAC name of (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium (CID 24866401) is (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium.
What is the SMILES notation for (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium?
The canonical SMILES for (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium is CCC[N+](CCC)(CCC)CCC.O=C([O-])[C@@H]1CCCN1.
What is the InChIKey of (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium?
The InChIKey is OWAAZPCZDYPEFJ-VWMHFEHESA-M. The full InChI is InChI=1S/C12H28N.C5H9NO2/c1-5-9-13(10-6-2,11-7-3)12-8-4;7-5(8)4-2-1-3-6-4/h5-12H2,1-4H3;4,6H,1-3H2,(H,7,8)/q+1;/p-1/t;4-/m.0/s1.
What are the key properties of (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium?
(2S)-pyrrolidine-2-carboxylate;tetrapropylazanium has a molecular weight of 300.49 g/mol, XLogP of 1.93, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-pyrrolidine-2-carboxylate;tetrapropylazanium is sourced from PubChem (CID 24866401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).