C25H64N5O10P — CID 176895346
tetrakis(2-hydroxyethyl(trimethyl)azanium);(2S)-pyrrolidine-2-carboxylate;phosphate (PubChem CID 176895346) has the molecular formula C25H64N5O10P and a molecular weight of 625.79 g/mol. Its IUPAC name is tetrakis(2-hydroxyethyl(trimethyl)azanium);(2S)-pyrrolidine-2-carboxylate;phosphate.
| Compound Name | tetrakis(2-hydroxyethyl(trimethyl)azanium);(2S)-pyrrolidine-2-carboxylate;phosphate |
|---|---|
| PubChem CID | 176895346 |
| Molecular Formula | C25H64N5O10P |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.44 |
| IUPAC Name | tetrakis(2-hydroxyethyl(trimethyl)azanium);(2S)-pyrrolidine-2-carboxylate;phosphate |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=C([O-])[C@@H]1CCCN1.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C5H9NO2.4C5H14NO.H3O4P/c7-5(8)4-2-1-3-6-4;4*1-6(2,3)4-5-7;1-5(2,3)4/h4,6H,1-3H2,(H,7,8);4*7H,4-5H2,1-3H3;(H3,1,2,3,4)/q;4*+1;/p-4/t4-;;;;;/m0...../s1 |
| InChIKey | HAROLEIAGBFGEN-OYNMXQSYSA-J |
| XLogP | -5.60 |
| TPSA | 219.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|