C17H31N3O2 — CID 141416876
1-methyl-3-octylimidazol-1-ium;(2S)-pyrrolidine-2-carboxylate (PubChem CID 141416876) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-methyl-3-octylimidazol-1-ium;(2S)-pyrrolidine-2-carboxylate.
| Compound Name | 1-methyl-3-octylimidazol-1-ium;(2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141416876 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 1-methyl-3-octylimidazol-1-ium;(2S)-pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCn1cc[n+](C)c1.O=C([O-])[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H23N2.C5H9NO2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;7-5(8)4-2-1-3-6-4/h10-12H,3-9H2,1-2H3;4,6H,1-3H2,(H,7,8)/q+1;/p-1/t;4-/m.0/s1 |
| InChIKey | JAXADCXRJZMRSP-VWMHFEHESA-M |
| XLogP | 1.16 |
| TPSA | 60.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|