C14H17N5O2 — CID 62006681
ethyl 2-[cyclopropyl-(1-phenyltetrazol-5-yl)amino]acetate (PubChem CID 62006681) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-(1-phenyltetrazol-5-yl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-(1-phenyltetrazol-5-yl)amino]acetate |
|---|---|
| PubChem CID | 62006681 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | ethyl 2-[cyclopropyl-(1-phenyltetrazol-5-yl)amino]acetate |
| SMILES | CCOC(=O)CN(c1nnnn1-c1ccccc1)C1CC1 |
| InChI | InChI=1S/C14H17N5O2/c1-2-21-13(20)10-18(11-8-9-11)14-15-16-17-19(14)12-6-4-3-5-7-12/h3-7,11H,2,8-10H2,1H3 |
| InChIKey | KBOPGJVASSMHHC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |