C15H8F3NO3S — CID 57027275
[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] benzoate (PubChem CID 57027275) has the molecular formula C15H8F3NO3S and a molecular weight of 339.29 g/mol. Its IUPAC name is [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] benzoate.
| Compound Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] benzoate |
|---|---|
| PubChem CID | 57027275 |
| Molecular Formula | C15H8F3NO3S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] benzoate |
| SMILES | O=C(Oc1nc2ccc(OC(F)(F)F)cc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H8F3NO3S/c16-15(17,18)22-10-6-7-11-12(8-10)23-14(19-11)21-13(20)9-4-2-1-3-5-9/h1-8H |
| InChIKey | HJGAHESRDQRMTH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |