C17H10N4O3S — CID 44885960
(E)-N-(1,3-benzothiazol-2-yl)-2-cyano-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 44885960) has the molecular formula C17H10N4O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-2-cyano-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-2-cyano-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44885960 |
| Molecular Formula | C17H10N4O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-2-cyano-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc([N+](=O)[O-])cc1)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H10N4O3S/c18-10-12(9-11-5-7-13(8-6-11)21(23)24)16(22)20-17-19-14-3-1-2-4-15(14)25-17/h1-9H,(H,19,20,22)/b12-9+ |
| InChIKey | BYJDWWZNZHPZSM-FMIVXFBMSA-N |
| XLogP | 3.75 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|