C20H11N3O3S2 — CID 4051083
2-[1-(1,3-benzothiazol-2-yl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzothiazole (PubChem CID 4051083) has the molecular formula C20H11N3O3S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[1-(1,3-benzothiazol-2-yl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[1-(1,3-benzothiazol-2-yl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 4051083 |
| Molecular Formula | C20H11N3O3S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2-[1-(1,3-benzothiazol-2-yl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C20H11N3O3S2/c24-23(25)18-10-9-12(26-18)11-13(19-21-14-5-1-3-7-16(14)27-19)20-22-15-6-2-4-8-17(15)28-20/h1-11H |
| InChIKey | YXPYBBHZKWQBHR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|