C14H10N2O5S — CID 7120964
[(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 5-nitrofuran-2-carboxylate (PubChem CID 7120964) has the molecular formula C14H10N2O5S and a molecular weight of 318.31 g/mol. Its IUPAC name is [(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 7120964 |
| Molecular Formula | C14H10N2O5S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 5-nitrofuran-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])o1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H10N2O5S/c1-8(13-15-9-4-2-3-5-11(9)22-13)20-14(17)10-6-7-12(21-10)16(18)19/h2-8H,1H3/t8-/m0/s1 |
| InChIKey | MSRBTKIMIXGDIS-QMMMGPOBSA-N |
| XLogP | 3.72 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|