C14H7N3O4 — CID 25111457
(E)-2-(1,3-benzoxazol-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enenitrile (PubChem CID 25111457) has the molecular formula C14H7N3O4 and a molecular weight of 281.23 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 25111457 |
| Molecular Formula | C14H7N3O4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc([N+](=O)[O-])o1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H7N3O4/c15-8-9(7-10-5-6-13(20-10)17(18)19)14-16-11-3-1-2-4-12(11)21-14/h1-7H/b9-7+ |
| InChIKey | ZYTRJXROMQJXNJ-VQHVLOKHSA-N |
| XLogP | 3.39 |
| TPSA | 106.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|