C17H17NO6P2S — CID 44580922
[(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)-1-phosphonoprop-2-enyl]phosphonic acid (PubChem CID 44580922) has the molecular formula C17H17NO6P2S and a molecular weight of 425.34 g/mol. Its IUPAC name is [(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)-1-phosphonoprop-2-enyl]phosphonic acid.
| Compound Name | [(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)-1-phosphonoprop-2-enyl]phosphonic acid |
|---|---|
| PubChem CID | 44580922 |
| Molecular Formula | C17H17NO6P2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | [(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-methylphenyl)-1-phosphonoprop-2-enyl]phosphonic acid |
| SMILES | Cc1ccc(/C=C(\c2nc3ccccc3s2)C(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C17H17NO6P2S/c1-11-6-8-12(9-7-11)10-13(17(25(19,20)21)26(22,23)24)16-18-14-4-2-3-5-15(14)27-16/h2-10,17H,1H3,(H2,19,20,21)(H2,22,23,24)/b13-10+ |
| InChIKey | PTLNOGYDCQLHTC-JLHYYAGUSA-N |
| XLogP | 3.83 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|