C22H15ClN2O3S — CID 4045786
2-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 4045786) has the molecular formula C22H15ClN2O3S and a molecular weight of 422.89 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4045786 |
| Molecular Formula | C22H15ClN2O3S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N-(4-chlorophenyl)-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(=Cc1ccc(O)c(O)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H15ClN2O3S/c23-14-6-8-15(9-7-14)24-21(28)16(11-13-5-10-18(26)19(27)12-13)22-25-17-3-1-2-4-20(17)29-22/h1-12,26-27H,(H,24,28) |
| InChIKey | GURNIKSSHIVZBQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|