C22H14Cl2N2OS — CID 22778274
(E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 22778274) has the molecular formula C22H14Cl2N2OS and a molecular weight of 425.34 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22778274 |
| Molecular Formula | C22H14Cl2N2OS |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Nc1ccc(Cl)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H14Cl2N2OS/c23-15-8-5-14(6-9-15)7-12-21(27)25-18-11-10-16(24)13-17(18)22-26-19-3-1-2-4-20(19)28-22/h1-13H,(H,25,27)/b12-7+ |
| InChIKey | YSWPPEGYKGROBQ-KPKJPENVSA-N |
| XLogP | 6.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|