C14H14N6O3S — CID 118722908
N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 118722908) has the molecular formula C14H14N6O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 118722908 |
| Molecular Formula | C14H14N6O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NCCCCn1cnc([N+](=O)[O-])n1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H14N6O3S/c21-12(13-17-10-5-1-2-6-11(10)24-13)15-7-3-4-8-19-9-16-14(18-19)20(22)23/h1-2,5-6,9H,3-4,7-8H2,(H,15,21) |
| InChIKey | GPUWDIMZJWMPME-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|