C13H15N9O3 — CID 19271612
1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide (PubChem CID 19271612) has the molecular formula C13H15N9O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271612 |
| Molecular Formula | C13H15N9O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[(3-nitro-1,2,4-triazol-1-yl)methyl]-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C13H15N9O3/c23-12(14-4-1-6-19-7-2-5-16-19)11-3-8-20(17-11)10-21-9-15-13(18-21)22(24)25/h2-3,5,7-9H,1,4,6,10H2,(H,14,23) |
| InChIKey | MVIBUFYQYGYQOS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|