C17H18F3N9O3 — CID 19271498
N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19271498) has the molecular formula C17H18F3N9O3 and a molecular weight of 453.39 g/mol. Its IUPAC name is N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271498 |
| Molecular Formula | C17H18F3N9O3 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)c1ccn(Cn2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C17H18F3N9O3/c18-17(19,20)14-8-13(11-2-3-11)28(24-14)6-1-5-21-15(30)12-4-7-26(23-12)10-27-9-22-16(25-27)29(31)32/h4,7-9,11H,1-3,5-6,10H2,(H,21,30) |
| InChIKey | XEMPGUKBOJGCOO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|