C24H28N4O3S3 — CID 142895757
N-[2-[4-[(4-carbamoyl-1-methylpiperidin-4-yl)-methylidene-oxo-λ6-sulfanyl]phenyl]sulfanylethyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 142895757) has the molecular formula C24H28N4O3S3 and a molecular weight of 516.71 g/mol. Its IUPAC name is N-[2-[4-[(4-carbamoyl-1-methylpiperidin-4-yl)-methylidene-oxo-λ6-sulfanyl]phenyl]sulfanylethyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-[4-[(4-carbamoyl-1-methylpiperidin-4-yl)-methylidene-oxo-λ6-sulfanyl]phenyl]sulfanylethyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 142895757 |
| Molecular Formula | C24H28N4O3S3 |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | N-[2-[4-[(4-carbamoyl-1-methylpiperidin-4-yl)-methylidene-oxo-λ6-sulfanyl]phenyl]sulfanylethyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | C=S(=O)(c1ccc(SCCNC(=O)c2nc3ccccc3s2)cc1)C1(C(N)=O)CCN(C)CC1 |
| InChI | InChI=1S/C24H28N4O3S3/c1-28-14-11-24(12-15-28,23(25)30)34(2,31)18-9-7-17(8-10-18)32-16-13-26-21(29)22-27-19-5-3-4-6-20(19)33-22/h3-10H,2,11-16H2,1H3,(H2,25,30)(H,26,29) |
| InChIKey | OWJRHHXEARLYIX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|