C23H22N4O4S — CID 125431365
(1R,9S,12S)-10-[2-(1,3-benzothiazole-2-carbonylamino)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 125431365) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is (1R,9S,12S)-10-[2-(1,3-benzothiazole-2-carbonylamino)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9S,12S)-10-[2-(1,3-benzothiazole-2-carbonylamino)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 125431365 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (1R,9S,12S)-10-[2-(1,3-benzothiazole-2-carbonylamino)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | C[C@@]12C[C@@H](c3ccccc3O1)[C@@H](C(N)=O)C(=O)N2CCNC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H22N4O4S/c1-23-12-14(13-6-2-4-8-16(13)31-23)18(19(24)28)22(30)27(23)11-10-25-20(29)21-26-15-7-3-5-9-17(15)32-21/h2-9,14,18H,10-12H2,1H3,(H2,24,28)(H,25,29)/t14-,18-,23-/m0/s1 |
| InChIKey | ZTEBHYPEVFKRPZ-IGMHASDESA-N |
| XLogP | 2.25 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|