C23H22FN3O3 — CID 125431099
(1R,9S,12S)-10-[2-(5-fluoro-1H-indol-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 125431099) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is (1R,9S,12S)-10-[2-(5-fluoro-1H-indol-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9S,12S)-10-[2-(5-fluoro-1H-indol-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 125431099 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (1R,9S,12S)-10-[2-(5-fluoro-1H-indol-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | C[C@@]12C[C@@H](c3ccccc3O1)[C@@H](C(N)=O)C(=O)N2CCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H22FN3O3/c1-23-11-17(15-4-2-3-5-19(15)30-23)20(21(25)28)22(29)27(23)9-8-13-12-26-18-7-6-14(24)10-16(13)18/h2-7,10,12,17,20,26H,8-9,11H2,1H3,(H2,25,28)/t17-,20-,23-/m0/s1 |
| InChIKey | IOUNTCGRCGFHJN-NYDSKATKSA-N |
| XLogP | 3.08 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|