C19H17FN2O3 — CID 132915606
5-fluoro-3-[(2R,4S)-2-methyl-4-(nitromethyl)-3,4-dihydrochromen-2-yl]-1H-indole (PubChem CID 132915606) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 5-fluoro-3-[(2R,4S)-2-methyl-4-(nitromethyl)-3,4-dihydrochromen-2-yl]-1H-indole.
| Compound Name | 5-fluoro-3-[(2R,4S)-2-methyl-4-(nitromethyl)-3,4-dihydrochromen-2-yl]-1H-indole |
|---|---|
| PubChem CID | 132915606 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-fluoro-3-[(2R,4S)-2-methyl-4-(nitromethyl)-3,4-dihydrochromen-2-yl]-1H-indole |
| SMILES | C[C@]1(c2c[nH]c3ccc(F)cc23)C[C@H](C[N+](=O)[O-])c2ccccc2O1 |
| InChI | InChI=1S/C19H17FN2O3/c1-19(16-10-21-17-7-6-13(20)8-15(16)17)9-12(11-22(23)24)14-4-2-3-5-18(14)25-19/h2-8,10,12,21H,9,11H2,1H3/t12-,19-/m1/s1 |
| InChIKey | XLKDTLDOQWTSHQ-CWTRNNRKSA-N |
| XLogP | 4.37 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|