C16H18NO5- — CID 7263628
(1R,9S,12S)-10-(2-methoxyethyl)-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylate (PubChem CID 7263628) has the molecular formula C16H18NO5- and a molecular weight of 304.32 g/mol. Its IUPAC name is (1R,9S,12S)-10-(2-methoxyethyl)-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylate.
| Compound Name | (1R,9S,12S)-10-(2-methoxyethyl)-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylate |
|---|---|
| PubChem CID | 7263628 |
| Molecular Formula | C16H18NO5- |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (1R,9S,12S)-10-(2-methoxyethyl)-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxylate |
| SMILES | COCCN1C(=O)[C@@H](C(=O)[O-])[C@H]2C[C@]1(C)Oc1ccccc12 |
| InChI | InChI=1S/C16H19NO5/c1-16-9-11(10-5-3-4-6-12(10)22-16)13(15(19)20)14(18)17(16)7-8-21-2/h3-6,11,13H,7-9H2,1-2H3,(H,19,20)/p-1/t11-,13-,16-/m0/s1 |
| InChIKey | ANWDCYJXIAXLRD-RBOXIYTFSA-M |
| XLogP | 0.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|