C19H24N6O4 — CID 125430943
(1R,9R,12R)-10-[2-[[2-(methoxymethyl)-1,2,4-triazol-3-yl]amino]ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 125430943) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is (1R,9R,12R)-10-[2-[[2-(methoxymethyl)-1,2,4-triazol-3-yl]amino]ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9R,12R)-10-[2-[[2-(methoxymethyl)-1,2,4-triazol-3-yl]amino]ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 125430943 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (1R,9R,12R)-10-[2-[[2-(methoxymethyl)-1,2,4-triazol-3-yl]amino]ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | COCn1ncnc1NCCN1C(=O)[C@@H](C(N)=O)[C@H]2C[C@@]1(C)Oc1ccccc12 |
| InChI | InChI=1S/C19H24N6O4/c1-19-9-13(12-5-3-4-6-14(12)29-19)15(16(20)26)17(27)24(19)8-7-21-18-22-10-23-25(18)11-28-2/h3-6,10,13,15H,7-9,11H2,1-2H3,(H2,20,26)(H,21,22,23)/t13-,15+,19+/m0/s1 |
| InChIKey | MSPMGKVQFNPTPB-ZBQZNYHESA-N |
| XLogP | 0.52 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|