C25H26N4O4 — CID 125428715
(1R,9R,12S)-9-methyl-10-[2-[(1-methylindole-2-carbonyl)amino]ethyl]-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 125428715) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (1R,9R,12S)-9-methyl-10-[2-[(1-methylindole-2-carbonyl)amino]ethyl]-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9R,12S)-9-methyl-10-[2-[(1-methylindole-2-carbonyl)amino]ethyl]-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 125428715 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (1R,9R,12S)-9-methyl-10-[2-[(1-methylindole-2-carbonyl)amino]ethyl]-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | Cn1c(C(=O)NCCN2C(=O)[C@H](C(N)=O)[C@H]3C[C@@]2(C)Oc2ccccc23)cc2ccccc21 |
| InChI | InChI=1S/C25H26N4O4/c1-25-14-17(16-8-4-6-10-20(16)33-25)21(22(26)30)24(32)29(25)12-11-27-23(31)19-13-15-7-3-5-9-18(15)28(19)2/h3-10,13,17,21H,11-12,14H2,1-2H3,(H2,26,30)(H,27,31)/t17-,21-,25+/m0/s1 |
| InChIKey | WARFPDSHJCOUEX-SBJAYZTMSA-N |
| XLogP | 2.13 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|