C18H18N2OS — CID 739215
N-[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]butanamide (PubChem CID 739215) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]butanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]butanamide |
|---|---|
| PubChem CID | 739215 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(-c2nc3ccccc3s2)c1C |
| InChI | InChI=1S/C18H18N2OS/c1-3-7-17(21)19-14-10-6-8-13(12(14)2)18-20-15-9-4-5-11-16(15)22-18/h4-6,8-11H,3,7H2,1-2H3,(H,19,21) |
| InChIKey | XYIZJGPYEJNTHC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |