C13H9NOS2 — CID 99868112
2-[(R)-phenylsulfinyl]-1,3-benzothiazole (PubChem CID 99868112) has the molecular formula C13H9NOS2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[(R)-phenylsulfinyl]-1,3-benzothiazole.
| Compound Name | 2-[(R)-phenylsulfinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 99868112 |
| Molecular Formula | C13H9NOS2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-[(R)-phenylsulfinyl]-1,3-benzothiazole |
| SMILES | O=[S@](c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H9NOS2/c15-17(10-6-2-1-3-7-10)13-14-11-8-4-5-9-12(11)16-13/h1-9H/t17-/m1/s1 |
| InChIKey | DTCZFUWAXPLPNA-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |