C11H8F3NOS2 — CID 118733212
2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-benzothiazole (PubChem CID 118733212) has the molecular formula C11H8F3NOS2 and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-benzothiazole.
| Compound Name | 2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 118733212 |
| Molecular Formula | C11H8F3NOS2 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-benzothiazole |
| SMILES | O=S(CCC(F)=C(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H8F3NOS2/c12-7(10(13)14)5-6-18(16)11-15-8-3-1-2-4-9(8)17-11/h1-4H,5-6H2 |
| InChIKey | BLIBQSQDAVHSFZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |