C9H7NOS2 — CID 94044917
2-[(R)-ethenylsulfinyl]-1,3-benzothiazole (PubChem CID 94044917) has the molecular formula C9H7NOS2 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2-[(R)-ethenylsulfinyl]-1,3-benzothiazole.
| Compound Name | 2-[(R)-ethenylsulfinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 94044917 |
| Molecular Formula | C9H7NOS2 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 2-[(R)-ethenylsulfinyl]-1,3-benzothiazole |
| SMILES | C=C[S@@](=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C9H7NOS2/c1-2-13(11)9-10-7-5-3-4-6-8(7)12-9/h2-6H,1H2/t13-/m1/s1 |
| InChIKey | VPEBNYFNQLYWPR-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |