C16H15NO2S3 — CID 101004247
2-[2-(4-methylphenyl)sulfinylethylsulfinyl]-1,3-benzothiazole (PubChem CID 101004247) has the molecular formula C16H15NO2S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)sulfinylethylsulfinyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(4-methylphenyl)sulfinylethylsulfinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 101004247 |
| Molecular Formula | C16H15NO2S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[2-(4-methylphenyl)sulfinylethylsulfinyl]-1,3-benzothiazole |
| SMILES | Cc1ccc(S(=O)CCS(=O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H15NO2S3/c1-12-6-8-13(9-7-12)21(18)10-11-22(19)16-17-14-4-2-3-5-15(14)20-16/h2-9H,10-11H2,1H3 |
| InChIKey | MDBFMUSFRGUSDE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |