C15H22N2OS2 — CID 141242081
N-(3-methylbutyl)-N-propyl-1,3-benzothiazole-2-sulfinamide (PubChem CID 141242081) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-propyl-1,3-benzothiazole-2-sulfinamide.
| Compound Name | N-(3-methylbutyl)-N-propyl-1,3-benzothiazole-2-sulfinamide |
|---|---|
| PubChem CID | 141242081 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-(3-methylbutyl)-N-propyl-1,3-benzothiazole-2-sulfinamide |
| SMILES | CCCN(CCC(C)C)S(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H22N2OS2/c1-4-10-17(11-9-12(2)3)20(18)15-16-13-7-5-6-8-14(13)19-15/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | QWKMIFWMDQTYKB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |