C13H12F3NOS2 — CID 91014111
2-(5,6,6-trifluorohex-1-enylsulfinyl)-1,3-benzothiazole (PubChem CID 91014111) has the molecular formula C13H12F3NOS2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-(5,6,6-trifluorohex-1-enylsulfinyl)-1,3-benzothiazole.
| Compound Name | 2-(5,6,6-trifluorohex-1-enylsulfinyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 91014111 |
| Molecular Formula | C13H12F3NOS2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-(5,6,6-trifluorohex-1-enylsulfinyl)-1,3-benzothiazole |
| SMILES | O=S(C=CCCC(F)C(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H12F3NOS2/c14-9(12(15)16)5-3-4-8-20(18)13-17-10-6-1-2-7-11(10)19-13/h1-2,4,6-9,12H,3,5H2 |
| InChIKey | KROSDMZICVEGIL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |